C19H20ClNO — CID 59448444
(4aS,10bR)-2-benzyl-7-chloro-1,3,4,4a,6,10b-hexahydroisochromeno[4,3-c]pyridine (PubChem CID 59448444) has the molecular formula C19H20ClNO and a molecular weight of 313.83 g/mol. Its IUPAC name is (4aS,10bR)-2-benzyl-7-chloro-1,3,4,4a,6,10b-hexahydroisochromeno[4,3-c]pyridine.
| Compound Name | (4aS,10bR)-2-benzyl-7-chloro-1,3,4,4a,6,10b-hexahydroisochromeno[4,3-c]pyridine |
|---|---|
| PubChem CID | 59448444 |
| Molecular Formula | C19H20ClNO |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (4aS,10bR)-2-benzyl-7-chloro-1,3,4,4a,6,10b-hexahydroisochromeno[4,3-c]pyridine |
| SMILES | Clc1cccc2c1CO[C@H]1CCN(Cc3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C19H20ClNO/c20-18-8-4-7-15-16-12-21(11-14-5-2-1-3-6-14)10-9-19(16)22-13-17(15)18/h1-8,16,19H,9-13H2/t16-,19-/m0/s1 |
| InChIKey | WQSRCHHPZDRMTA-LPHOPBHVSA-N |
| XLogP | 4.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |