C37H55N7O2 — CID 53315859
2-(4-benzyl-1,4-diazepan-1-yl)-6-methoxy-7-(3-piperidin-1-ylpropoxy)-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine (PubChem CID 53315859) has the molecular formula C37H55N7O2 and a molecular weight of 629.89 g/mol. Its IUPAC name is 2-(4-benzyl-1,4-diazepan-1-yl)-6-methoxy-7-(3-piperidin-1-ylpropoxy)-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine.
| Compound Name | 2-(4-benzyl-1,4-diazepan-1-yl)-6-methoxy-7-(3-piperidin-1-ylpropoxy)-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 53315859 |
| Molecular Formula | C37H55N7O2 |
| Molecular Weight | 629.89 g/mol |
| Exact Mass | 629.44 |
| IUPAC Name | 2-(4-benzyl-1,4-diazepan-1-yl)-6-methoxy-7-(3-piperidin-1-ylpropoxy)-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine |
| SMILES | COc1cc2c(NC3CCN(C(C)C)CC3)nc(N3CCCN(Cc4ccccc4)CC3)nc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C37H55N7O2/c1-29(2)43-21-14-31(15-22-43)38-36-32-26-34(45-3)35(46-25-11-19-41-16-8-5-9-17-41)27-33(32)39-37(40-36)44-20-10-18-42(23-24-44)28-30-12-6-4-7-13-30/h4,6-7,12-13,26-27,29,31H,5,8-11,14-25,28H2,1-3H3,(H,38,39,40) |
| InChIKey | MBIZZDYZILKRDE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.89 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|