C26H35N5O4 — CID 137390224
tert-butyl (3R)-3-[(6-methoxy-7-prop-2-ynoxy-2-pyrrolidin-1-ylquinazolin-4-yl)amino]piperidine-1-carboxylate (PubChem CID 137390224) has the molecular formula C26H35N5O4 and a molecular weight of 481.60 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(6-methoxy-7-prop-2-ynoxy-2-pyrrolidin-1-ylquinazolin-4-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(6-methoxy-7-prop-2-ynoxy-2-pyrrolidin-1-ylquinazolin-4-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137390224 |
| Molecular Formula | C26H35N5O4 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | tert-butyl (3R)-3-[(6-methoxy-7-prop-2-ynoxy-2-pyrrolidin-1-ylquinazolin-4-yl)amino]piperidine-1-carboxylate |
| SMILES | C#CCOc1cc2nc(N3CCCC3)nc(N[C@@H]3CCCN(C(=O)OC(C)(C)C)C3)c2cc1OC |
| InChI | InChI=1S/C26H35N5O4/c1-6-14-34-22-16-20-19(15-21(22)33-5)23(29-24(28-20)30-11-7-8-12-30)27-18-10-9-13-31(17-18)25(32)35-26(2,3)4/h1,15-16,18H,7-14,17H2,2-5H3,(H,27,28,29)/t18-/m1/s1 |
| InChIKey | JOPQFEZZHABXPT-GOSISDBHSA-N |
| XLogP | 4.06 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|