C22H27N5 — CID 69015335
4-N-cyclohexyl-6-[3-(dimethylamino)phenyl]quinazoline-2,4-diamine (PubChem CID 69015335) has the molecular formula C22H27N5 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-N-cyclohexyl-6-[3-(dimethylamino)phenyl]quinazoline-2,4-diamine.
| Compound Name | 4-N-cyclohexyl-6-[3-(dimethylamino)phenyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 69015335 |
| Molecular Formula | C22H27N5 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 4-N-cyclohexyl-6-[3-(dimethylamino)phenyl]quinazoline-2,4-diamine |
| SMILES | CN(C)c1cccc(-c2ccc3nc(N)nc(NC4CCCCC4)c3c2)c1 |
| InChI | InChI=1S/C22H27N5/c1-27(2)18-10-6-7-15(13-18)16-11-12-20-19(14-16)21(26-22(23)25-20)24-17-8-4-3-5-9-17/h6-7,10-14,17H,3-5,8-9H2,1-2H3,(H3,23,24,25,26) |
| InChIKey | FNVPTLQBIUVVKC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |