About 4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine
4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine (PubChem CID 69014715) has the molecular formula C25H30N4O2
and a molecular weight of 418.54 g/mol. Its IUPAC name is 4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine |
| PubChem CID | 69014715 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine |
| SMILES | Nc1nc(NC2CCCCC2)c2cc(-c3ccc(OC4CCCCO4)cc3)ccc2n1 |
| InChI | InChI=1S/C25H30N4O2/c26-25-28-22-14-11-18(16-21(22)24(29-25)27-19-6-2-1-3-7-19)17-9-12-20(13-10-17)31-23-8-4-5-15-30-23/h9-14,16,19,23H,1-8,15H2,(H3,26,27,28,29) |
| InChIKey | ZOXPWVWQUFOQJH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine?
The IUPAC name of 4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine (CID 69014715) is 4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine.
What is the SMILES notation for 4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine?
The canonical SMILES for 4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine is Nc1nc(NC2CCCCC2)c2cc(-c3ccc(OC4CCCCO4)cc3)ccc2n1.
What is the InChIKey of 4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine?
The InChIKey is ZOXPWVWQUFOQJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N4O2/c26-25-28-22-14-11-18(16-21(22)24(29-25)27-19-6-2-1-3-7-19)17-9-12-20(13-10-17)31-23-8-4-5-15-30-23/h9-14,16,19,23H,1-8,15H2,(H3,26,27,28,29).
What are the key properties of 4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine?
4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine has a molecular weight of 418.54 g/mol, XLogP of 5.53, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-cyclohexyl-6-[4-(oxan-2-yloxy)phenyl]quinazoline-2,4-diamine is sourced from PubChem (CID 69014715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).