C23H20ClN3O2 — CID 22693150
N-benzhydryl-2-chloro-6,7-dimethoxyquinazolin-4-amine (PubChem CID 22693150) has the molecular formula C23H20ClN3O2 and a molecular weight of 405.89 g/mol. Its IUPAC name is N-benzhydryl-2-chloro-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | N-benzhydryl-2-chloro-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 22693150 |
| Molecular Formula | C23H20ClN3O2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-benzhydryl-2-chloro-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2nc(Cl)nc(NC(c3ccccc3)c3ccccc3)c2cc1OC |
| InChI | InChI=1S/C23H20ClN3O2/c1-28-19-13-17-18(14-20(19)29-2)25-23(24)27-22(17)26-21(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-14,21H,1-2H3,(H,25,26,27) |
| InChIKey | BPLMRCRESDIQLW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |