About 2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol
2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol (PubChem CID 171561808) has the molecular formula C12H9ClN4O2
and a molecular weight of 276.68 g/mol. Its IUPAC name is 2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol.
Molecular Properties
| Compound Name | 2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol |
| PubChem CID | 171561808 |
| Molecular Formula | C12H9ClN4O2 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol |
| SMILES | Oc1cccc2c(NCc3ncco3)nc(Cl)nc12 |
| InChI | InChI=1S/C12H9ClN4O2/c13-12-16-10-7(2-1-3-8(10)18)11(17-12)15-6-9-14-4-5-19-9/h1-5,18H,6H2,(H,15,16,17) |
| InChIKey | LDMCKGUGQFDIHI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol?
The IUPAC name of 2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol (CID 171561808) is 2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol.
What is the SMILES notation for 2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol?
The canonical SMILES for 2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol is Oc1cccc2c(NCc3ncco3)nc(Cl)nc12.
What is the InChIKey of 2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol?
The InChIKey is LDMCKGUGQFDIHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClN4O2/c13-12-16-10-7(2-1-3-8(10)18)11(17-12)15-6-9-14-4-5-19-9/h1-5,18H,6H2,(H,15,16,17).
What are the key properties of 2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol?
2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol has a molecular weight of 276.68 g/mol, XLogP of 2.59, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(1,3-oxazol-2-ylmethylamino)quinazolin-8-ol is sourced from PubChem (CID 171561808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).