C18H16ClN3O4 — CID 22692970
3-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-4-methylbenzoic acid (PubChem CID 22692970) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is 3-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-4-methylbenzoic acid.
| Compound Name | 3-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 22692970 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 3-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-4-methylbenzoic acid |
| SMILES | COc1cc2nc(Cl)nc(Nc3cc(C(=O)O)ccc3C)c2cc1OC |
| InChI | InChI=1S/C18H16ClN3O4/c1-9-4-5-10(17(23)24)6-12(9)20-16-11-7-14(25-2)15(26-3)8-13(11)21-18(19)22-16/h4-8H,1-3H3,(H,23,24)(H,20,21,22) |
| InChIKey | FQXJKSFVJXMSCF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |