C13H18N4 — CID 5396624
N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-1H-benzimidazol-2-amine (PubChem CID 5396624) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 5396624 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-1H-benzimidazol-2-amine |
| SMILES | C/C(=N/Nc1nc2ccccc2[nH]1)C(C)(C)C |
| InChI | InChI=1S/C13H18N4/c1-9(13(2,3)4)16-17-12-14-10-7-5-6-8-11(10)15-12/h5-8H,1-4H3,(H2,14,15,17)/b16-9- |
| InChIKey | VARAXLWGKKJTJS-SXGWCWSVSA-N |
| XLogP | 3.40 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|