C16H14F2N2OS — CID 60585452
2-[1-[4-(difluoromethoxy)phenyl]ethylsulfanyl]-1H-benzimidazole (PubChem CID 60585452) has the molecular formula C16H14F2N2OS and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-[1-[4-(difluoromethoxy)phenyl]ethylsulfanyl]-1H-benzimidazole.
| Compound Name | 2-[1-[4-(difluoromethoxy)phenyl]ethylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 60585452 |
| Molecular Formula | C16H14F2N2OS |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-[1-[4-(difluoromethoxy)phenyl]ethylsulfanyl]-1H-benzimidazole |
| SMILES | CC(Sc1nc2ccccc2[nH]1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H14F2N2OS/c1-10(11-6-8-12(9-7-11)21-15(17)18)22-16-19-13-4-2-3-5-14(13)20-16/h2-10,15H,1H3,(H,19,20) |
| InChIKey | YVFVWIQNHXPRIC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |