C12H16N2S — CID 42135960
2-[(2S)-2-methylbutyl]sulfanyl-1H-benzimidazole (PubChem CID 42135960) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 2-[(2S)-2-methylbutyl]sulfanyl-1H-benzimidazole.
| Compound Name | 2-[(2S)-2-methylbutyl]sulfanyl-1H-benzimidazole |
|---|---|
| PubChem CID | 42135960 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[(2S)-2-methylbutyl]sulfanyl-1H-benzimidazole |
| SMILES | CC[C@H](C)CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H16N2S/c1-3-9(2)8-15-12-13-10-6-4-5-7-11(10)14-12/h4-7,9H,3,8H2,1-2H3,(H,13,14)/t9-/m0/s1 |
| InChIKey | XPEKZVQAQABDKW-VIFPVBQESA-N |
| XLogP | 3.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |