C11H11N3S — CID 43242882
3-(1H-benzimidazol-2-ylsulfanyl)-2-methylpropanenitrile (PubChem CID 43242882) has the molecular formula C11H11N3S and a molecular weight of 217.30 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-ylsulfanyl)-2-methylpropanenitrile.
| Compound Name | 3-(1H-benzimidazol-2-ylsulfanyl)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 43242882 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-(1H-benzimidazol-2-ylsulfanyl)-2-methylpropanenitrile |
| SMILES | CC(C#N)CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H11N3S/c1-8(6-12)7-15-11-13-9-4-2-3-5-10(9)14-11/h2-5,8H,7H2,1H3,(H,13,14) |
| InChIKey | HWOWXWFAXRRNAM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |