C9H10N6S — CID 7825141
5-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 7825141) has the molecular formula C9H10N6S and a molecular weight of 234.29 g/mol. Its IUPAC name is 5-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 7825141 |
| Molecular Formula | C9H10N6S |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 5-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | C/C(=N\Nc1nc(=S)[nH][nH]1)c1ccccn1 |
| InChI | InChI=1S/C9H10N6S/c1-6(7-4-2-3-5-10-7)12-13-8-11-9(16)15-14-8/h2-5H,1H3,(H3,11,13,14,15,16)/b12-6+ |
| InChIKey | LYBVRFYONQSMIZ-WUXMJOGZSA-N |
| XLogP | 1.70 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|