C15H15N7S — CID 7914135
N-[(E)-1-pyridin-2-ylethylideneamino]-3-(pyridin-2-ylmethylsulfanyl)-1H-1,2,4-triazol-5-amine (PubChem CID 7914135) has the molecular formula C15H15N7S and a molecular weight of 325.40 g/mol. Its IUPAC name is N-[(E)-1-pyridin-2-ylethylideneamino]-3-(pyridin-2-ylmethylsulfanyl)-1H-1,2,4-triazol-5-amine.
| Compound Name | N-[(E)-1-pyridin-2-ylethylideneamino]-3-(pyridin-2-ylmethylsulfanyl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 7914135 |
| Molecular Formula | C15H15N7S |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[(E)-1-pyridin-2-ylethylideneamino]-3-(pyridin-2-ylmethylsulfanyl)-1H-1,2,4-triazol-5-amine |
| SMILES | C/C(=N\Nc1nc(SCc2ccccn2)n[nH]1)c1ccccn1 |
| InChI | InChI=1S/C15H15N7S/c1-11(13-7-3-5-9-17-13)19-20-14-18-15(22-21-14)23-10-12-6-2-4-8-16-12/h2-9H,10H2,1H3,(H2,18,20,21,22)/b19-11+ |
| InChIKey | SVWBXRBZVYVALN-YBFXNURJSA-N |
| XLogP | 2.72 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|