C17H15F2N5S — CID 7913924
N-[(E)-1-(4-fluorophenyl)ethylideneamino]-3-[(4-fluorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine (PubChem CID 7913924) has the molecular formula C17H15F2N5S and a molecular weight of 359.41 g/mol. Its IUPAC name is N-[(E)-1-(4-fluorophenyl)ethylideneamino]-3-[(4-fluorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine.
| Compound Name | N-[(E)-1-(4-fluorophenyl)ethylideneamino]-3-[(4-fluorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 7913924 |
| Molecular Formula | C17H15F2N5S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N-[(E)-1-(4-fluorophenyl)ethylideneamino]-3-[(4-fluorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine |
| SMILES | C/C(=N\Nc1nc(SCc2ccc(F)cc2)n[nH]1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15F2N5S/c1-11(13-4-8-15(19)9-5-13)21-22-16-20-17(24-23-16)25-10-12-2-6-14(18)7-3-12/h2-9H,10H2,1H3,(H2,20,22,23,24)/b21-11+ |
| InChIKey | IWLXPHAHMYGHEN-SRZZPIQSSA-N |
| XLogP | 4.21 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|