C16H13BrFN5S — CID 7941879
N-[(Z)-(3-bromophenyl)methylideneamino]-3-[(4-fluorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine (PubChem CID 7941879) has the molecular formula C16H13BrFN5S and a molecular weight of 406.28 g/mol. Its IUPAC name is N-[(Z)-(3-bromophenyl)methylideneamino]-3-[(4-fluorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine.
| Compound Name | N-[(Z)-(3-bromophenyl)methylideneamino]-3-[(4-fluorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 7941879 |
| Molecular Formula | C16H13BrFN5S |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | N-[(Z)-(3-bromophenyl)methylideneamino]-3-[(4-fluorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine |
| SMILES | Fc1ccc(CSc2n[nH]c(N/N=C\c3cccc(Br)c3)n2)cc1 |
| InChI | InChI=1S/C16H13BrFN5S/c17-13-3-1-2-12(8-13)9-19-21-15-20-16(23-22-15)24-10-11-4-6-14(18)7-5-11/h1-9H,10H2,(H2,20,21,22,23)/b19-9- |
| InChIKey | GVYPBKCMZNHYMO-OCKHKDLRSA-N |
| XLogP | 4.44 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|