C18H16BrN7OS2 — CID 29021488
2-[[5-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(2S)-2,3-dihydro-1,3-benzothiazol-2-yl]acetamide (PubChem CID 29021488) has the molecular formula C18H16BrN7OS2 and a molecular weight of 490.41 g/mol. Its IUPAC name is 2-[[5-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(2S)-2,3-dihydro-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | 2-[[5-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(2S)-2,3-dihydro-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 29021488 |
| Molecular Formula | C18H16BrN7OS2 |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 489.00 |
| IUPAC Name | 2-[[5-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(2S)-2,3-dihydro-1,3-benzothiazol-2-yl]acetamide |
| SMILES | O=C(CSc1n[nH]c(N/N=C\c2cccc(Br)c2)n1)N[C@@H]1Nc2ccccc2S1 |
| InChI | InChI=1S/C18H16BrN7OS2/c19-12-5-3-4-11(8-12)9-20-24-16-23-18(26-25-16)28-10-15(27)22-17-21-13-6-1-2-7-14(13)29-17/h1-9,17,21H,10H2,(H,22,27)(H2,23,24,25,26)/b20-9-/t17-/m0/s1 |
| InChIKey | BLJTUOMTHVMSIZ-WMEYIKMASA-N |
| XLogP | 3.72 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|