C20H20N6O2S — CID 7947084
N-cyclopropyl-2-[[5-[(2Z)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 7947084) has the molecular formula C20H20N6O2S and a molecular weight of 408.49 g/mol. Its IUPAC name is N-cyclopropyl-2-[[5-[(2Z)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-cyclopropyl-2-[[5-[(2Z)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7947084 |
| Molecular Formula | C20H20N6O2S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-cyclopropyl-2-[[5-[(2Z)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1n[nH]c(N/N=C\c2cccc(Oc3ccccc3)c2)n1)NC1CC1 |
| InChI | InChI=1S/C20H20N6O2S/c27-18(22-15-9-10-15)13-29-20-23-19(25-26-20)24-21-12-14-5-4-8-17(11-14)28-16-6-2-1-3-7-16/h1-8,11-12,15H,9-10,13H2,(H,22,27)(H2,23,24,25,26)/b21-12- |
| InChIKey | FBKWTJQUUPIZNT-MTJSOVHGSA-N |
| XLogP | 3.41 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|