C16H21N7OS — CID 7913367
N-cyclopentyl-2-[[5-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 7913367) has the molecular formula C16H21N7OS and a molecular weight of 359.46 g/mol. Its IUPAC name is N-cyclopentyl-2-[[5-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-cyclopentyl-2-[[5-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7913367 |
| Molecular Formula | C16H21N7OS |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-cyclopentyl-2-[[5-[(2E)-2-(1-pyridin-2-ylethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C/C(=N\Nc1nc(SCC(=O)NC2CCCC2)n[nH]1)c1ccccn1 |
| InChI | InChI=1S/C16H21N7OS/c1-11(13-8-4-5-9-17-13)20-21-15-19-16(23-22-15)25-10-14(24)18-12-6-2-3-7-12/h4-5,8-9,12H,2-3,6-7,10H2,1H3,(H,18,24)(H2,19,21,22,23)/b20-11+ |
| InChIKey | JUGOMLOATJINEO-RGVLZGJSSA-N |
| XLogP | 2.19 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|