C14H14N4OS — CID 58904928
N-cyclopropyl-2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 58904928) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is N-cyclopropyl-2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-cyclopropyl-2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 58904928 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-cyclopropyl-2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nccc(-c2ccccn2)n1)NC1CC1 |
| InChI | InChI=1S/C14H14N4OS/c19-13(17-10-4-5-10)9-20-14-16-8-6-12(18-14)11-3-1-2-7-15-11/h1-3,6-8,10H,4-5,9H2,(H,17,19) |
| InChIKey | VYOUVNLXSUDJAG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |