C17H20N4O3S — CID 58904853
3-(propanoylamino)propyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate (PubChem CID 58904853) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 3-(propanoylamino)propyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate.
| Compound Name | 3-(propanoylamino)propyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 58904853 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-(propanoylamino)propyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
| SMILES | CCC(=O)NCCCOC(=O)CSc1nccc(-c2ccccn2)n1 |
| InChI | InChI=1S/C17H20N4O3S/c1-2-15(22)19-9-5-11-24-16(23)12-25-17-20-10-7-14(21-17)13-6-3-4-8-18-13/h3-4,6-8,10H,2,5,9,11-12H2,1H3,(H,19,22) |
| InChIKey | VJQHVSRLHRYBEI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|