C24H27N5O3S — CID 58904901
2-[(4-tert-butylphenyl)carbamoylamino]ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate (PubChem CID 58904901) has the molecular formula C24H27N5O3S and a molecular weight of 465.58 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)carbamoylamino]ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate.
| Compound Name | 2-[(4-tert-butylphenyl)carbamoylamino]ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 58904901 |
| Molecular Formula | C24H27N5O3S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 2-[(4-tert-butylphenyl)carbamoylamino]ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCCOC(=O)CSc2nccc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C24H27N5O3S/c1-24(2,3)17-7-9-18(10-8-17)28-22(31)26-14-15-32-21(30)16-33-23-27-13-11-20(29-23)19-6-4-5-12-25-19/h4-13H,14-16H2,1-3H3,(H2,26,28,31) |
| InChIKey | AFYWXEULZRCIOJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|