C15H17F3N3O2PS — CID 142164815
ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate (PubChem CID 142164815) has the molecular formula C15H17F3N3O2PS and a molecular weight of 391.36 g/mol. Its IUPAC name is ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate.
| Compound Name | ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 142164815 |
| Molecular Formula | C15H17F3N3O2PS |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
| SMILES | CC.O=C(CSc1nccc(-c2ccccn2)n1)OC(P)C(F)(F)F |
| InChI | InChI=1S/C13H11F3N3O2PS.C2H6/c14-13(15,16)11(22)21-10(20)7-23-12-18-6-4-9(19-12)8-3-1-2-5-17-8;1-2/h1-6,11H,7,22H2;1-2H3 |
| InChIKey | VDNBAOYLPBEDOQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|