About ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate
ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate (PubChem CID 142164815) has the molecular formula C15H17F3N3O2PS
and a molecular weight of 391.36 g/mol. Its IUPAC name is ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate.
Molecular Properties
| Compound Name | ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
| PubChem CID | 142164815 |
| Molecular Formula | C15H17F3N3O2PS |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
| SMILES | CC.O=C(CSc1nccc(-c2ccccn2)n1)OC(P)C(F)(F)F |
| InChI | InChI=1S/C13H11F3N3O2PS.C2H6/c14-13(15,16)11(22)21-10(20)7-23-12-18-6-4-9(19-12)8-3-1-2-5-17-8;1-2/h1-6,11H,7,22H2;1-2H3 |
| InChIKey | VDNBAOYLPBEDOQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate?
The IUPAC name of ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate (CID 142164815) is ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate.
What is the SMILES notation for ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate?
The canonical SMILES for ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate is CC.O=C(CSc1nccc(-c2ccccn2)n1)OC(P)C(F)(F)F.
What is the InChIKey of ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate?
The InChIKey is VDNBAOYLPBEDOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N3O2PS.C2H6/c14-13(15,16)11(22)21-10(20)7-23-12-18-6-4-9(19-12)8-3-1-2-5-17-8;1-2/h1-6,11H,7,22H2;1-2H3.
What are the key properties of ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate?
ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate has a molecular weight of 391.36 g/mol, XLogP of 3.96, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2,2,2-trifluoro-1-phosphanylethyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate is sourced from PubChem (CID 142164815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).