C17H18N4O4S — CID 58904917
2-(diacetylamino)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate (PubChem CID 58904917) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is 2-(diacetylamino)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate.
| Compound Name | 2-(diacetylamino)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 58904917 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-(diacetylamino)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
| SMILES | CC(=O)N(CCOC(=O)CSc1nccc(-c2ccccn2)n1)C(C)=O |
| InChI | InChI=1S/C17H18N4O4S/c1-12(22)21(13(2)23)9-10-25-16(24)11-26-17-19-8-6-15(20-17)14-5-3-4-7-18-14/h3-8H,9-11H2,1-2H3 |
| InChIKey | BNUYSVCJLMIGBG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 102.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |