C17H19N3O4S — CID 58904978
propan-2-yl 2-[2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetyl]oxypropanoate (PubChem CID 58904978) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is propan-2-yl 2-[2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetyl]oxypropanoate.
| Compound Name | propan-2-yl 2-[2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetyl]oxypropanoate |
|---|---|
| PubChem CID | 58904978 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | propan-2-yl 2-[2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetyl]oxypropanoate |
| SMILES | CC(C)OC(=O)C(C)OC(=O)CSc1nccc(-c2ccccn2)n1 |
| InChI | InChI=1S/C17H19N3O4S/c1-11(2)23-16(22)12(3)24-15(21)10-25-17-19-9-7-14(20-17)13-6-4-5-8-18-13/h4-9,11-12H,10H2,1-3H3 |
| InChIKey | YRANNPQJPIFBOF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 91.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |