C15H11F4N3O2S — CID 58905042
(2,2,3,3-tetrafluorocyclobutyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate (PubChem CID 58905042) has the molecular formula C15H11F4N3O2S and a molecular weight of 373.33 g/mol. Its IUPAC name is (2,2,3,3-tetrafluorocyclobutyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate.
| Compound Name | (2,2,3,3-tetrafluorocyclobutyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 58905042 |
| Molecular Formula | C15H11F4N3O2S |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | (2,2,3,3-tetrafluorocyclobutyl) 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
| SMILES | O=C(CSc1nccc(-c2ccccn2)n1)OC1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C15H11F4N3O2S/c16-14(17)7-11(15(14,18)19)24-12(23)8-25-13-21-6-4-10(22-13)9-3-1-2-5-20-9/h1-6,11H,7-8H2 |
| InChIKey | CVVVIELDHLRBDX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|