About ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate
ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate (PubChem CID 142164830) has the molecular formula C18H23N3O3S
and a molecular weight of 361.47 g/mol. Its IUPAC name is ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate.
Molecular Properties
| Compound Name | ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
| PubChem CID | 142164830 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
| SMILES | CC.O=C(CSc1nccc(-c2ccccn2)n1)OC1CCCOC1 |
| InChI | InChI=1S/C16H17N3O3S.C2H6/c20-15(22-12-4-3-9-21-10-12)11-23-16-18-8-6-14(19-16)13-5-1-2-7-17-13;1-2/h1-2,5-8,12H,3-4,9-11H2;1-2H3 |
| InChIKey | CFEMFAAZNNQQMP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate?
The IUPAC name of ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate (CID 142164830) is ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate.
What is the SMILES notation for ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate?
The canonical SMILES for ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate is CC.O=C(CSc1nccc(-c2ccccn2)n1)OC1CCCOC1.
What is the InChIKey of ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate?
The InChIKey is CFEMFAAZNNQQMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3S.C2H6/c20-15(22-12-4-3-9-21-10-12)11-23-16-18-8-6-14(19-16)13-5-1-2-7-17-13;1-2/h1-2,5-8,12H,3-4,9-11H2;1-2H3.
What are the key properties of ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate?
ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate has a molecular weight of 361.47 g/mol, XLogP of 3.38, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;oxan-3-yl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate is sourced from PubChem (CID 142164830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).