C20H22N6O2S — CID 7894062
2-[[5-[(2Z)-2-benzylidenehydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 7894062) has the molecular formula C20H22N6O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[[5-[(2Z)-2-benzylidenehydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[[5-[(2Z)-2-benzylidenehydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 7894062 |
| Molecular Formula | C20H22N6O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[[5-[(2Z)-2-benzylidenehydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CSc2n[nH]c(N/N=C\c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H22N6O2S/c1-28-17-9-7-15(8-10-17)11-12-21-18(27)14-29-20-23-19(25-26-20)24-22-13-16-5-3-2-4-6-16/h2-10,13H,11-12,14H2,1H3,(H,21,27)(H2,23,24,25,26)/b22-13- |
| InChIKey | DABQUYJKPXQMJG-XKZIYDEJSA-N |
| XLogP | 2.71 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|