C18H20N6OS2 — CID 28693600
N-(2-phenylethyl)-2-[[5-[(2Z)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 28693600) has the molecular formula C18H20N6OS2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-[[5-[(2Z)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-phenylethyl)-2-[[5-[(2Z)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 28693600 |
| Molecular Formula | C18H20N6OS2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-(2-phenylethyl)-2-[[5-[(2Z)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C/C(=N/Nc1nc(SCC(=O)NCCc2ccccc2)n[nH]1)c1cccs1 |
| InChI | InChI=1S/C18H20N6OS2/c1-13(15-8-5-11-26-15)21-22-17-20-18(24-23-17)27-12-16(25)19-10-9-14-6-3-2-4-7-14/h2-8,11H,9-10,12H2,1H3,(H,19,25)(H2,20,22,23,24)/b21-13- |
| InChIKey | NPUPYWZPQCYGHA-BKUYFWCQSA-N |
| XLogP | 3.15 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|