C15H20N4OS — CID 35814934
2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenylbutyl)acetamide (PubChem CID 35814934) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenylbutyl)acetamide.
| Compound Name | 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 35814934 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-phenylbutyl)acetamide |
| SMILES | Cc1nc(SCC(=O)NCCCCc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C15H20N4OS/c1-12-17-15(19-18-12)21-11-14(20)16-10-6-5-9-13-7-3-2-4-8-13/h2-4,7-8H,5-6,9-11H2,1H3,(H,16,20)(H,17,18,19) |
| InChIKey | LHMCRJHZKMCUJG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|