C17H17N5O2S2 — CID 17369513
benzyl 2-[[5-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 17369513) has the molecular formula C17H17N5O2S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is benzyl 2-[[5-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | benzyl 2-[[5-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 17369513 |
| Molecular Formula | C17H17N5O2S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | benzyl 2-[[5-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | C/C(=N\Nc1nc(SCC(=O)OCc2ccccc2)n[nH]1)c1cccs1 |
| InChI | InChI=1S/C17H17N5O2S2/c1-12(14-8-5-9-25-14)19-20-16-18-17(22-21-16)26-11-15(23)24-10-13-6-3-2-4-7-13/h2-9H,10-11H2,1H3,(H2,18,20,21,22)/b19-12+ |
| InChIKey | AEMAEPLVAYXGMP-XDHOZWIPSA-N |
| XLogP | 3.54 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|