C15H21N5S — CID 41177711
3-(3-methylbutylsulfanyl)-N-[(Z)-1-phenylethylideneamino]-1H-1,2,4-triazol-5-amine (PubChem CID 41177711) has the molecular formula C15H21N5S and a molecular weight of 303.44 g/mol. Its IUPAC name is 3-(3-methylbutylsulfanyl)-N-[(Z)-1-phenylethylideneamino]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-(3-methylbutylsulfanyl)-N-[(Z)-1-phenylethylideneamino]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 41177711 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 3-(3-methylbutylsulfanyl)-N-[(Z)-1-phenylethylideneamino]-1H-1,2,4-triazol-5-amine |
| SMILES | C/C(=N/Nc1nc(SCCC(C)C)n[nH]1)c1ccccc1 |
| InChI | InChI=1S/C15H21N5S/c1-11(2)9-10-21-15-16-14(19-20-15)18-17-12(3)13-7-5-4-6-8-13/h4-8,11H,9-10H2,1-3H3,(H2,16,18,19,20)/b17-12- |
| InChIKey | RENHFDYZRCIOLF-ATVHPVEESA-N |
| XLogP | 3.78 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|