C16H17N7S — CID 28691528
N-[(E)-1-(4-aminophenyl)ethylideneamino]-3-(pyridin-4-ylmethylsulfanyl)-1H-1,2,4-triazol-5-amine (PubChem CID 28691528) has the molecular formula C16H17N7S and a molecular weight of 339.43 g/mol. Its IUPAC name is N-[(E)-1-(4-aminophenyl)ethylideneamino]-3-(pyridin-4-ylmethylsulfanyl)-1H-1,2,4-triazol-5-amine.
| Compound Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-3-(pyridin-4-ylmethylsulfanyl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 28691528 |
| Molecular Formula | C16H17N7S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-3-(pyridin-4-ylmethylsulfanyl)-1H-1,2,4-triazol-5-amine |
| SMILES | C/C(=N\Nc1nc(SCc2ccncc2)n[nH]1)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H17N7S/c1-11(13-2-4-14(17)5-3-13)20-21-15-19-16(23-22-15)24-10-12-6-8-18-9-7-12/h2-9H,10,17H2,1H3,(H2,19,21,22,23)/b20-11+ |
| InChIKey | GRUIQNJJYUANRS-RGVLZGJSSA-N |
| XLogP | 2.91 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|