C21H23N5O2S — CID 17369096
N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-3-[(2,4,6-trimethylphenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine (PubChem CID 17369096) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-3-[(2,4,6-trimethylphenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine.
| Compound Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-3-[(2,4,6-trimethylphenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 17369096 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-3-[(2,4,6-trimethylphenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine |
| SMILES | C/C(=N/Nc1nc(SCc2c(C)cc(C)cc2C)n[nH]1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H23N5O2S/c1-12-7-13(2)17(14(3)8-12)10-29-21-22-20(25-26-21)24-23-15(4)16-5-6-18-19(9-16)28-11-27-18/h5-9H,10-11H2,1-4H3,(H2,22,24,25,26)/b23-15- |
| InChIKey | DPYURLBLXYFTOK-HAHDFKILSA-N |
| XLogP | 4.59 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|