C19H19Cl2N5S — CID 17369066
N-[(E)-(2,3-dichlorophenyl)methylideneamino]-3-[(2,4,6-trimethylphenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine (PubChem CID 17369066) has the molecular formula C19H19Cl2N5S and a molecular weight of 420.37 g/mol. Its IUPAC name is N-[(E)-(2,3-dichlorophenyl)methylideneamino]-3-[(2,4,6-trimethylphenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine.
| Compound Name | N-[(E)-(2,3-dichlorophenyl)methylideneamino]-3-[(2,4,6-trimethylphenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 17369066 |
| Molecular Formula | C19H19Cl2N5S |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N-[(E)-(2,3-dichlorophenyl)methylideneamino]-3-[(2,4,6-trimethylphenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine |
| SMILES | Cc1cc(C)c(CSc2n[nH]c(N/N=C/c3cccc(Cl)c3Cl)n2)c(C)c1 |
| InChI | InChI=1S/C19H19Cl2N5S/c1-11-7-12(2)15(13(3)8-11)10-27-19-23-18(25-26-19)24-22-9-14-5-4-6-16(20)17(14)21/h4-9H,10H2,1-3H3,(H2,23,24,25,26)/b22-9+ |
| InChIKey | KUSFRLHDDCGUTB-LSFURLLWSA-N |
| XLogP | 5.78 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|