C11H10Cl2N6OS — CID 17369065
2-[[5-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17369065) has the molecular formula C11H10Cl2N6OS and a molecular weight of 345.22 g/mol. Its IUPAC name is 2-[[5-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | 2-[[5-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17369065 |
| Molecular Formula | C11H10Cl2N6OS |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 2-[[5-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | NC(=O)CSc1n[nH]c(N/N=C/c2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C11H10Cl2N6OS/c12-7-3-1-2-6(9(7)13)4-15-17-10-16-11(19-18-10)21-5-8(14)20/h1-4H,5H2,(H2,14,20)(H2,16,17,18,19)/b15-4+ |
| InChIKey | WHQPKPJHYOMMBZ-SYZQJQIISA-N |
| XLogP | 2.13 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|