C17H14F2N6O2S — CID 135743808
N-(2,4-difluorophenyl)-2-[[5-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 135743808) has the molecular formula C17H14F2N6O2S and a molecular weight of 404.40 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[[5-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[[5-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135743808 |
| Molecular Formula | C17H14F2N6O2S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[[5-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1n[nH]c(N/N=C/c2ccccc2O)n1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H14F2N6O2S/c18-11-5-6-13(12(19)7-11)21-15(27)9-28-17-22-16(24-25-17)23-20-8-10-3-1-2-4-14(10)26/h1-8,26H,9H2,(H,21,27)(H2,22,23,24,25)/b20-8+ |
| InChIKey | VTNMDCLLXIXGON-DNTJNYDQSA-N |
| XLogP | 2.97 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|