C18H16F2N6O3S — CID 135900734
N-(3,4-difluorophenyl)-2-[[5-[(2Z)-2-[(2-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 135900734) has the molecular formula C18H16F2N6O3S and a molecular weight of 434.43 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[[5-[(2Z)-2-[(2-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[[5-[(2Z)-2-[(2-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135900734 |
| Molecular Formula | C18H16F2N6O3S |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[[5-[(2Z)-2-[(2-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(O)c(/C=N\Nc2nc(SCC(=O)Nc3ccc(F)c(F)c3)n[nH]2)c1 |
| InChI | InChI=1S/C18H16F2N6O3S/c1-29-12-3-5-15(27)10(6-12)8-21-24-17-23-18(26-25-17)30-9-16(28)22-11-2-4-13(19)14(20)7-11/h2-8,27H,9H2,1H3,(H,22,28)(H2,23,24,25,26)/b21-8- |
| InChIKey | GZFIBOQOMBLQDQ-WNFQYIGGSA-N |
| XLogP | 2.97 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|