C18H13Cl2F3N6OS — CID 17369023
2-[[5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 17369023) has the molecular formula C18H13Cl2F3N6OS and a molecular weight of 489.31 g/mol. Its IUPAC name is 2-[[5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17369023 |
| Molecular Formula | C18H13Cl2F3N6OS |
| Molecular Weight | 489.31 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | 2-[[5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1n[nH]c(N/N=C/c2ccc(Cl)cc2Cl)n1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13Cl2F3N6OS/c19-12-5-4-10(14(20)7-12)8-24-27-16-26-17(29-28-16)31-9-15(30)25-13-3-1-2-11(6-13)18(21,22)23/h1-8H,9H2,(H,25,30)(H2,26,27,28,29)/b24-8+ |
| InChIKey | FCIFBQOALDNXPB-KTZMUZOWSA-N |
| XLogP | 5.31 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|