C19H20N6OS — CID 7922753
2-[[5-[(2Z)-2-benzylidenehydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 7922753) has the molecular formula C19H20N6OS and a molecular weight of 380.48 g/mol. Its IUPAC name is 2-[[5-[(2Z)-2-benzylidenehydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2-[[5-[(2Z)-2-benzylidenehydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 7922753 |
| Molecular Formula | C19H20N6OS |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-[[5-[(2Z)-2-benzylidenehydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | C[C@H](NC(=O)CSc1n[nH]c(N/N=C\c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C19H20N6OS/c1-14(16-10-6-3-7-11-16)21-17(26)13-27-19-22-18(24-25-19)23-20-12-15-8-4-2-5-9-15/h2-12,14H,13H2,1H3,(H,21,26)(H2,22,23,24,25)/b20-12-/t14-/m0/s1 |
| InChIKey | XAESEUSCKAJLIK-GQFJFNLSSA-N |
| XLogP | 3.22 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|