C14H15N5O4S — CID 6210253
methyl 2-[[5-[(2Z)-2-[1-(1,3-benzodioxol-5-yl)ethylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 6210253) has the molecular formula C14H15N5O4S and a molecular weight of 349.37 g/mol. Its IUPAC name is methyl 2-[[5-[(2Z)-2-[1-(1,3-benzodioxol-5-yl)ethylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[(2Z)-2-[1-(1,3-benzodioxol-5-yl)ethylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 6210253 |
| Molecular Formula | C14H15N5O4S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | methyl 2-[[5-[(2Z)-2-[1-(1,3-benzodioxol-5-yl)ethylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1n[nH]c(N/N=C(/C)c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C14H15N5O4S/c1-8(9-3-4-10-11(5-9)23-7-22-10)16-17-13-15-14(19-18-13)24-6-12(20)21-2/h3-5H,6-7H2,1-2H3,(H2,15,17,18,19)/b16-8- |
| InChIKey | IHBCRUOSWCHCKX-PXNMLYILSA-N |
| XLogP | 1.63 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|