C17H17N7O3S — CID 17288391
1-(1,3-benzodioxol-5-yl)-2-[[5-[(2E)-2-[(1-ethylpyrazol-4-yl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 17288391) has the molecular formula C17H17N7O3S and a molecular weight of 399.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-[[5-[(2E)-2-[(1-ethylpyrazol-4-yl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-[[5-[(2E)-2-[(1-ethylpyrazol-4-yl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 17288391 |
| Molecular Formula | C17H17N7O3S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-[[5-[(2E)-2-[(1-ethylpyrazol-4-yl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | CCn1cc(/C=N/Nc2nc(SCC(=O)c3ccc4c(c3)OCO4)n[nH]2)cn1 |
| InChI | InChI=1S/C17H17N7O3S/c1-2-24-8-11(7-19-24)6-18-21-16-20-17(23-22-16)28-9-13(25)12-3-4-14-15(5-12)27-10-26-14/h3-8H,2,9-10H2,1H3,(H2,20,21,22,23)/b18-6+ |
| InChIKey | ONXPMHXEGDKJRW-NGYBGAFCSA-N |
| XLogP | 2.17 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|