C21H25N7OS — CID 7830719
2-[[5-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methylphenyl)methyl]acetamide (PubChem CID 7830719) has the molecular formula C21H25N7OS and a molecular weight of 423.55 g/mol. Its IUPAC name is 2-[[5-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methylphenyl)methyl]acetamide.
| Compound Name | 2-[[5-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 7830719 |
| Molecular Formula | C21H25N7OS |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[[5-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CSc2n[nH]c(N/N=C\c3ccc(N(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C21H25N7OS/c1-15-4-6-16(7-5-15)12-22-19(29)14-30-21-24-20(26-27-21)25-23-13-17-8-10-18(11-9-17)28(2)3/h4-11,13H,12,14H2,1-3H3,(H,22,29)(H2,24,25,26,27)/b23-13- |
| InChIKey | UYGNAUHNKMIGJA-QRVIBDJDSA-N |
| XLogP | 3.03 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|