C16H15ClN6O2S — CID 28977822
2-[[5-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 28977822) has the molecular formula C16H15ClN6O2S and a molecular weight of 390.86 g/mol. Its IUPAC name is 2-[[5-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[[5-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 28977822 |
| Molecular Formula | C16H15ClN6O2S |
| Molecular Weight | 390.86 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-[[5-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CSc1n[nH]c(N/N=C\c2ccc(Cl)cc2)n1)NCc1ccco1 |
| InChI | InChI=1S/C16H15ClN6O2S/c17-12-5-3-11(4-6-12)8-19-21-15-20-16(23-22-15)26-10-14(24)18-9-13-2-1-7-25-13/h1-8H,9-10H2,(H,18,24)(H2,20,21,22,23)/b19-8- |
| InChIKey | DRDNDWSPSJZGHG-UWVJOHFNSA-N |
| XLogP | 2.91 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.86 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|