C18H18N6O2S2 — CID 71834729
2-[[5-[2-(furan-2-ylmethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-prop-2-enylsulfanylphenyl)acetamide (PubChem CID 71834729) has the molecular formula C18H18N6O2S2 and a molecular weight of 414.52 g/mol. Its IUPAC name is 2-[[5-[2-(furan-2-ylmethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-prop-2-enylsulfanylphenyl)acetamide.
| Compound Name | 2-[[5-[2-(furan-2-ylmethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-prop-2-enylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 71834729 |
| Molecular Formula | C18H18N6O2S2 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-[[5-[2-(furan-2-ylmethylidene)hydrazinyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-prop-2-enylsulfanylphenyl)acetamide |
| SMILES | C=CCSc1ccccc1NC(=O)CSc1n[nH]c(NN=Cc2ccco2)n1 |
| InChI | InChI=1S/C18H18N6O2S2/c1-2-10-27-15-8-4-3-7-14(15)20-16(25)12-28-18-21-17(23-24-18)22-19-11-13-6-5-9-26-13/h2-9,11H,1,10,12H2,(H,20,25)(H2,21,22,23,24) |
| InChIKey | JOKHXGAQSXUENW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|