C11H13N5O2S — CID 17346027
3-(2-ethenoxyethylsulfanyl)-N-[(E)-furan-2-ylmethylideneamino]-1H-1,2,4-triazol-5-amine (PubChem CID 17346027) has the molecular formula C11H13N5O2S and a molecular weight of 279.33 g/mol. Its IUPAC name is 3-(2-ethenoxyethylsulfanyl)-N-[(E)-furan-2-ylmethylideneamino]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-(2-ethenoxyethylsulfanyl)-N-[(E)-furan-2-ylmethylideneamino]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 17346027 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-(2-ethenoxyethylsulfanyl)-N-[(E)-furan-2-ylmethylideneamino]-1H-1,2,4-triazol-5-amine |
| SMILES | C=COCCSc1n[nH]c(N/N=C/c2ccco2)n1 |
| InChI | InChI=1S/C11H13N5O2S/c1-2-17-6-7-19-11-13-10(15-16-11)14-12-8-9-4-3-5-18-9/h2-5,8H,1,6-7H2,(H2,13,14,15,16)/b12-8+ |
| InChIKey | QAFDSMBEZBCGBC-XYOKQWHBSA-N |
| XLogP | 2.10 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|