C12H13N6O3S- — CID 7858194
4-nitro-2-[(Z)-[(3-propylsulfanyl-1H-1,2,4-triazol-5-yl)hydrazinylidene]methyl]phenolate (PubChem CID 7858194) has the molecular formula C12H13N6O3S- and a molecular weight of 321.34 g/mol. Its IUPAC name is 4-nitro-2-[(Z)-[(3-propylsulfanyl-1H-1,2,4-triazol-5-yl)hydrazinylidene]methyl]phenolate.
| Compound Name | 4-nitro-2-[(Z)-[(3-propylsulfanyl-1H-1,2,4-triazol-5-yl)hydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 7858194 |
| Molecular Formula | C12H13N6O3S- |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-nitro-2-[(Z)-[(3-propylsulfanyl-1H-1,2,4-triazol-5-yl)hydrazinylidene]methyl]phenolate |
| SMILES | CCCSc1n[nH]c(N/N=C\c2cc([N+](=O)[O-])ccc2[O-])n1 |
| InChI | InChI=1S/C12H14N6O3S/c1-2-5-22-12-14-11(16-17-12)15-13-7-8-6-9(18(20)21)3-4-10(8)19/h3-4,6-7,19H,2,5H2,1H3,(H2,14,15,16,17)/p-1/b13-7- |
| InChIKey | VODOPPXWKKNQEP-QPEQYQDCSA-M |
| XLogP | 1.73 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|