C13H8F2N3O3- — CID 9058300
2-[(Z)-[(2,4-difluorophenyl)hydrazinylidene]methyl]-4-nitrophenolate (PubChem CID 9058300) has the molecular formula C13H8F2N3O3- and a molecular weight of 292.22 g/mol. Its IUPAC name is 2-[(Z)-[(2,4-difluorophenyl)hydrazinylidene]methyl]-4-nitrophenolate.
| Compound Name | 2-[(Z)-[(2,4-difluorophenyl)hydrazinylidene]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 9058300 |
| Molecular Formula | C13H8F2N3O3- |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-[(Z)-[(2,4-difluorophenyl)hydrazinylidene]methyl]-4-nitrophenolate |
| SMILES | O=[N+]([O-])c1ccc([O-])c(/C=N\Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C13H9F2N3O3/c14-9-1-3-12(11(15)6-9)17-16-7-8-5-10(18(20)21)2-4-13(8)19/h1-7,17,19H/p-1/b16-7- |
| InChIKey | RZLVFHJIJKVEFI-APSNUPSMSA-M |
| XLogP | 2.39 |
| TPSA | 90.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|