C15H18N6O2S — CID 28958312
3-cyclohexylsulfanyl-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazol-5-amine (PubChem CID 28958312) has the molecular formula C15H18N6O2S and a molecular weight of 346.42 g/mol. Its IUPAC name is 3-cyclohexylsulfanyl-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-cyclohexylsulfanyl-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 28958312 |
| Molecular Formula | C15H18N6O2S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 3-cyclohexylsulfanyl-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazol-5-amine |
| SMILES | O=[N+]([O-])c1ccc(/C=N\Nc2nc(SC3CCCCC3)n[nH]2)cc1 |
| InChI | InChI=1S/C15H18N6O2S/c22-21(23)12-8-6-11(7-9-12)10-16-18-14-17-15(20-19-14)24-13-4-2-1-3-5-13/h6-10,13H,1-5H2,(H2,17,18,19,20)/b16-10- |
| InChIKey | DYVZHGABYWWJCH-YBEGLDIGSA-N |
| XLogP | 3.58 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|