C17H23N5OS — CID 28701384
3-cyclohexylsulfanyl-N-[(Z)-(4-ethoxyphenyl)methylideneamino]-1H-1,2,4-triazol-5-amine (PubChem CID 28701384) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 3-cyclohexylsulfanyl-N-[(Z)-(4-ethoxyphenyl)methylideneamino]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-cyclohexylsulfanyl-N-[(Z)-(4-ethoxyphenyl)methylideneamino]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 28701384 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-cyclohexylsulfanyl-N-[(Z)-(4-ethoxyphenyl)methylideneamino]-1H-1,2,4-triazol-5-amine |
| SMILES | CCOc1ccc(/C=N\Nc2nc(SC3CCCCC3)n[nH]2)cc1 |
| InChI | InChI=1S/C17H23N5OS/c1-2-23-14-10-8-13(9-11-14)12-18-20-16-19-17(22-21-16)24-15-6-4-3-5-7-15/h8-12,15H,2-7H2,1H3,(H2,19,20,21,22)/b18-12- |
| InChIKey | PYTNQBNEAYIVNL-PDGQHHTCSA-N |
| XLogP | 4.07 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|